Contact
Email me to order a design or decoration project, supervision, or ask general questions
Chemical Name:2-Dimethylaminoisopropyl chloride hydrochloride
Molecular Formula:C5H13Cl2N
Formula Weight:158.07
CAS No.:4584-49-0
| Name | 2-Dimethylaminoisopropyl chloride hydrochloride |
| CAS No. | 4584-49-0 |
| EINECS NO. | 224-971-7 |
| Molecular Formula | C5H13ClN |
| Molecular Structure | ![]() |
| Molecular Weight | 122.6159 |
| InChI | InChI=1/C5H12ClN/c1-5(6)4-7(2)3/h5H,4H2,1-3H3/p+1/t5-/m0/s1 |
| Flash point | 2.9°C |
| Melting point | 191-195℃ |
| Water-soluble | 2000 g/L (20℃) |
Other product:4,5-Dimethyl-1,3-dioxol-2-one/DMDO/37830-90-3
Email me to order a design or decoration project, supervision, or ask general questions